About N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide
N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 141373204) has the molecular formula C11H8F3N5O4S
and a molecular weight of 363.28 g/mol. Its IUPAC name is N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 141373204 |
| Molecular Formula | C11H8F3N5O4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | COc1nc(C(F)(F)F)c(C(=O)Nc2nc(N)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H8F3N5O4S/c1-23-10-17-7(11(12,13)14)6(24-10)9(20)18-8-4(19(21)22)2-3-5(15)16-8/h2-3H,1H3,(H3,15,16,18,20) |
| InChIKey | XVNIOZUOIZPDAL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (CID 141373204) is N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide is COc1nc(C(F)(F)F)c(C(=O)Nc2nc(N)ccc2[N+](=O)[O-])s1.
What is the InChIKey of N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
The InChIKey is XVNIOZUOIZPDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F3N5O4S/c1-23-10-17-7(11(12,13)14)6(24-10)9(20)18-8-4(19(21)22)2-3-5(15)16-8/h2-3H,1H3,(H3,15,16,18,20).
What are the key properties of N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide has a molecular weight of 363.28 g/mol, XLogP of 2.31, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-3-nitro-2-pyridinyl)-2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 141373204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).