About 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide
2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide (PubChem CID 141374398) has the molecular formula C12H7ClF2N4O
and a molecular weight of 296.66 g/mol. Its IUPAC name is 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide |
| PubChem CID | 141374398 |
| Molecular Formula | C12H7ClF2N4O |
| Molecular Weight | 296.66 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide |
| SMILES | N#Cc1cc(NC(=O)CCl)n(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H7ClF2N4O/c13-5-12(20)17-11-4-8(6-16)18-19(11)10-2-1-7(14)3-9(10)15/h1-4H,5H2,(H,17,20) |
| InChIKey | MPRLFNBODFKTQX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide?
The IUPAC name of 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide (CID 141374398) is 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide.
What is the SMILES notation for 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide?
The canonical SMILES for 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide is N#Cc1cc(NC(=O)CCl)n(-c2ccc(F)cc2F)n1.
What is the InChIKey of 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide?
The InChIKey is MPRLFNBODFKTQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClF2N4O/c13-5-12(20)17-11-4-8(6-16)18-19(11)10-2-1-7(14)3-9(10)15/h1-4H,5H2,(H,17,20).
What are the key properties of 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide?
2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide has a molecular weight of 296.66 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3-cyano-1-(2,4-difluorophenyl)pyrazol-5-yl]acetamide is sourced from PubChem (CID 141374398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).