C19H20N2O2S — CID 141374732
7-piperazin-1-yl-3-(3-sulfanylphenyl)-3,4-dihydroisochromen-1-one (PubChem CID 141374732) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 7-piperazin-1-yl-3-(3-sulfanylphenyl)-3,4-dihydroisochromen-1-one.
| Compound Name | 7-piperazin-1-yl-3-(3-sulfanylphenyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 141374732 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 7-piperazin-1-yl-3-(3-sulfanylphenyl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OC(c2cccc(S)c2)Cc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C19H20N2O2S/c22-19-17-12-15(21-8-6-20-7-9-21)5-4-13(17)11-18(23-19)14-2-1-3-16(24)10-14/h1-5,10,12,18,20,24H,6-9,11H2 |
| InChIKey | FBBSVYJKJGZGDP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|