About 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol
4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol (PubChem CID 141374848) has the molecular formula C11H10FNO
and a molecular weight of 191.21 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol |
| PubChem CID | 141374848 |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol |
| SMILES | OC1CN=CC=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C11H10FNO/c12-9-3-1-8(2-4-9)10-5-6-13-7-11(10)14/h1-6,11,14H,7H2 |
| InChIKey | WKIUPJOLJKCIHE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol?
The IUPAC name of 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol (CID 141374848) is 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol.
What is the SMILES notation for 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol?
The canonical SMILES for 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol is OC1CN=CC=C1c1ccc(F)cc1.
What is the InChIKey of 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol?
The InChIKey is WKIUPJOLJKCIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO/c12-9-3-1-8(2-4-9)10-5-6-13-7-11(10)14/h1-6,11,14H,7H2.
What are the key properties of 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol?
4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol has a molecular weight of 191.21 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-2,3-dihydropyridin-3-ol is sourced from PubChem (CID 141374848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).