About N-cyclohexyl-5,6-dimethylpyrimidin-4-amine
N-cyclohexyl-5,6-dimethylpyrimidin-4-amine (PubChem CID 141374950) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is N-cyclohexyl-5,6-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-5,6-dimethylpyrimidin-4-amine |
| PubChem CID | 141374950 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-cyclohexyl-5,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1ncnc(NC2CCCCC2)c1C |
| InChI | InChI=1S/C12H19N3/c1-9-10(2)13-8-14-12(9)15-11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H,13,14,15) |
| InChIKey | IHRVZUISBOEQMV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-5,6-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5,6-dimethylpyrimidin-4-amine?
The IUPAC name of N-cyclohexyl-5,6-dimethylpyrimidin-4-amine (CID 141374950) is N-cyclohexyl-5,6-dimethylpyrimidin-4-amine.
What is the SMILES notation for N-cyclohexyl-5,6-dimethylpyrimidin-4-amine?
The canonical SMILES for N-cyclohexyl-5,6-dimethylpyrimidin-4-amine is Cc1ncnc(NC2CCCCC2)c1C.
What is the InChIKey of N-cyclohexyl-5,6-dimethylpyrimidin-4-amine?
The InChIKey is IHRVZUISBOEQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-9-10(2)13-8-14-12(9)15-11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H,13,14,15).
What are the key properties of N-cyclohexyl-5,6-dimethylpyrimidin-4-amine?
N-cyclohexyl-5,6-dimethylpyrimidin-4-amine has a molecular weight of 205.31 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5,6-dimethylpyrimidin-4-amine is sourced from PubChem (CID 141374950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).