About N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine
N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine (PubChem CID 141374951) has the molecular formula C12H17F2N3
and a molecular weight of 241.28 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine |
| PubChem CID | 141374951 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1ncnc(NC2CCC(F)(F)CC2)c1C |
| InChI | InChI=1S/C12H17F2N3/c1-8-9(2)15-7-16-11(8)17-10-3-5-12(13,14)6-4-10/h7,10H,3-6H2,1-2H3,(H,15,16,17) |
| InChIKey | DURWERXBODSXDF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine?
The IUPAC name of N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine (CID 141374951) is N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine is Cc1ncnc(NC2CCC(F)(F)CC2)c1C.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine?
The InChIKey is DURWERXBODSXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3/c1-8-9(2)15-7-16-11(8)17-10-3-5-12(13,14)6-4-10/h7,10H,3-6H2,1-2H3,(H,15,16,17).
What are the key properties of N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine?
N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine has a molecular weight of 241.28 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-5,6-dimethylpyrimidin-4-amine is sourced from PubChem (CID 141374951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).