C20H34O4 — CID 14137512
(Z)-2-[2-[(1S,2R,4aS,8aR)-4a,5-bis(hydroxymethyl)-1,2-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]but-2-ene-1,4-diol (PubChem CID 14137512) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (Z)-2-[2-[(1S,2R,4aS,8aR)-4a,5-bis(hydroxymethyl)-1,2-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]but-2-ene-1,4-diol.
| Compound Name | (Z)-2-[2-[(1S,2R,4aS,8aR)-4a,5-bis(hydroxymethyl)-1,2-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 14137512 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (Z)-2-[2-[(1S,2R,4aS,8aR)-4a,5-bis(hydroxymethyl)-1,2-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]but-2-ene-1,4-diol |
| SMILES | C[C@@H]1CC[C@@]2(CO)C(CO)=CCC[C@@H]2[C@@]1(C)CC/C(=C/CO)CO |
| InChI | InChI=1S/C20H34O4/c1-15-6-10-20(14-24)17(13-23)4-3-5-18(20)19(15,2)9-7-16(12-22)8-11-21/h4,8,15,18,21-24H,3,5-7,9-14H2,1-2H3/b16-8-/t15-,18-,19+,20-/m1/s1 |
| InChIKey | KZBUOBLJHGAMHA-XEYLXHPYSA-N |
| XLogP | 2.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|