C15H20O5S — CID 141375235
ethyl 2-(benzenesulfonyl)-4,4-dimethyl-3-oxopentanoate (PubChem CID 141375235) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonyl)-4,4-dimethyl-3-oxopentanoate.
| Compound Name | ethyl 2-(benzenesulfonyl)-4,4-dimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 141375235 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | ethyl 2-(benzenesulfonyl)-4,4-dimethyl-3-oxopentanoate |
| SMILES | CCOC(=O)C(C(=O)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O5S/c1-5-20-14(17)12(13(16)15(2,3)4)21(18,19)11-9-7-6-8-10-11/h6-10,12H,5H2,1-4H3 |
| InChIKey | CCCVNUMNVGWWFU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|