About tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane
tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane (PubChem CID 141376114) has the molecular formula C20H28N2Si
and a molecular weight of 324.54 g/mol. Its IUPAC name is tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane |
| PubChem CID | 141376114 |
| Molecular Formula | C20H28N2Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)N1CCCNC1 |
| InChI | InChI=1S/C20H28N2Si/c1-20(2,3)23(18-11-6-4-7-12-18,19-13-8-5-9-14-19)22-16-10-15-21-17-22/h4-9,11-14,21H,10,15-17H2,1-3H3 |
| InChIKey | MLNRYZPGDBUORJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane?
The IUPAC name of tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane (CID 141376114) is tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane.
What is the SMILES notation for tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane?
The canonical SMILES for tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane is CC(C)(C)[Si](c1ccccc1)(c1ccccc1)N1CCCNC1.
What is the InChIKey of tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane?
The InChIKey is MLNRYZPGDBUORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2Si/c1-20(2,3)23(18-11-6-4-7-12-18,19-13-8-5-9-14-19)22-16-10-15-21-17-22/h4-9,11-14,21H,10,15-17H2,1-3H3.
What are the key properties of tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane?
tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane has a molecular weight of 324.54 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(1,3-diazinan-1-yl)-diphenylsilane is sourced from PubChem (CID 141376114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).