About 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one
3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one (PubChem CID 141376357) has the molecular formula C23H25N3O2
and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one |
| PubChem CID | 141376357 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one |
| SMILES | CN1CCN(c2ccc3c(c2)OC(=O)C(c2cn(C)c4ccccc24)C3)CC1 |
| InChI | InChI=1S/C23H25N3O2/c1-24-9-11-26(12-10-24)17-8-7-16-13-19(23(27)28-22(16)14-17)20-15-25(2)21-6-4-3-5-18(20)21/h3-8,14-15,19H,9-13H2,1-2H3 |
| InChIKey | HTURJCOOJLYJHR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one?
The IUPAC name of 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one (CID 141376357) is 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one.
What is the SMILES notation for 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one?
The canonical SMILES for 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one is CN1CCN(c2ccc3c(c2)OC(=O)C(c2cn(C)c4ccccc24)C3)CC1.
What is the InChIKey of 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one?
The InChIKey is HTURJCOOJLYJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2/c1-24-9-11-26(12-10-24)17-8-7-16-13-19(23(27)28-22(16)14-17)20-15-25(2)21-6-4-3-5-18(20)21/h3-8,14-15,19H,9-13H2,1-2H3.
What are the key properties of 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one?
3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one has a molecular weight of 375.47 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylindol-3-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one is sourced from PubChem (CID 141376357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).