C24H28N4O2 — CID 141376445
3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-7-(4-propan-2-ylpiperazin-1-yl)-3,4-dihydrochromen-2-one (PubChem CID 141376445) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-7-(4-propan-2-ylpiperazin-1-yl)-3,4-dihydrochromen-2-one.
| Compound Name | 3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-7-(4-propan-2-ylpiperazin-1-yl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376445 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-7-(4-propan-2-ylpiperazin-1-yl)-3,4-dihydrochromen-2-one |
| SMILES | Cc1cn2cc(C3Cc4ccc(N5CCN(C(C)C)CC5)cc4OC3=O)cc2cn1 |
| InChI | InChI=1S/C24H28N4O2/c1-16(2)26-6-8-27(9-7-26)20-5-4-18-11-22(24(29)30-23(18)12-20)19-10-21-13-25-17(3)14-28(21)15-19/h4-5,10,12-16,22H,6-9,11H2,1-3H3 |
| InChIKey | ITPNIIUGDXRFJJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|