C23H26N4O2 — CID 141376521
7-(4-ethylpiperazin-1-yl)-3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one (PubChem CID 141376521) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 7-(4-ethylpiperazin-1-yl)-3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one.
| Compound Name | 7-(4-ethylpiperazin-1-yl)-3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376521 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 7-(4-ethylpiperazin-1-yl)-3-(3-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one |
| SMILES | CCN1CCN(c2ccc3c(c2)OC(=O)C(c2cc4cnc(C)cn4c2)C3)CC1 |
| InChI | InChI=1S/C23H26N4O2/c1-3-25-6-8-26(9-7-25)19-5-4-17-11-21(23(28)29-22(17)12-19)18-10-20-13-24-16(2)14-27(20)15-18/h4-5,10,12-15,21H,3,6-9,11H2,1-2H3 |
| InChIKey | ZCJFVOXPONGAHD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|