About 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one
7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one (PubChem CID 141376578) has the molecular formula C22H24N4O2
and a molecular weight of 376.46 g/mol. Its IUPAC name is 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one |
| PubChem CID | 141376578 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one |
| SMILES | Cc1nccn2cc(C3Cc4ccc(N5CCN(C)CC5)cc4OC3=O)cc12 |
| InChI | InChI=1S/C22H24N4O2/c1-15-20-12-17(14-26(20)6-5-23-15)19-11-16-3-4-18(13-21(16)28-22(19)27)25-9-7-24(2)8-10-25/h3-6,12-14,19H,7-11H2,1-2H3 |
| InChIKey | ZKAHMPODENIEOH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one?
The IUPAC name of 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one (CID 141376578) is 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one.
What is the SMILES notation for 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one?
The canonical SMILES for 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one is Cc1nccn2cc(C3Cc4ccc(N5CCN(C)CC5)cc4OC3=O)cc12.
What is the InChIKey of 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one?
The InChIKey is ZKAHMPODENIEOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O2/c1-15-20-12-17(14-26(20)6-5-23-15)19-11-16-3-4-18(13-21(16)28-22(19)27)25-9-7-24(2)8-10-25/h3-6,12-14,19H,7-11H2,1-2H3.
What are the key properties of 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one?
7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one has a molecular weight of 376.46 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrrolo[1,2-a]pyrazin-7-yl)-3,4-dihydrochromen-2-one is sourced from PubChem (CID 141376578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).