C23H25N3O2 — CID 141376632
7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-yl-3,4-dihydrochromen-2-one (PubChem CID 141376632) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-yl-3,4-dihydrochromen-2-one.
| Compound Name | 7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376632 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-yl-3,4-dihydrochromen-2-one |
| SMILES | C[C@@H]1CN(c2ccc3c(c2)OC(=O)C(c2cc4ccccn4c2)C3)C[C@H](C)N1 |
| InChI | InChI=1S/C23H25N3O2/c1-15-12-26(13-16(2)24-15)20-7-6-17-10-21(23(27)28-22(17)11-20)18-9-19-5-3-4-8-25(19)14-18/h3-9,11,14-16,21,24H,10,12-13H2,1-2H3/t15-,16+,21? |
| InChIKey | JPDMPTSFGBRCBY-GWTOYCKXSA-N |
| XLogP | 3.37 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|