About 6-methyl-3,4-dihydroacridin-9-amine
6-methyl-3,4-dihydroacridin-9-amine (PubChem CID 141376880) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-methyl-3,4-dihydroacridin-9-amine.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydroacridin-9-amine |
| PubChem CID | 141376880 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 6-methyl-3,4-dihydroacridin-9-amine |
| SMILES | Cc1ccc2c(N)c3c(nc2c1)CCC=C3 |
| InChI | InChI=1S/C14H14N2/c1-9-6-7-11-13(8-9)16-12-5-3-2-4-10(12)14(11)15/h2,4,6-8H,3,5H2,1H3,(H2,15,16) |
| InChIKey | MKOMZRZNEJJQST-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3,4-dihydroacridin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydroacridin-9-amine?
The IUPAC name of 6-methyl-3,4-dihydroacridin-9-amine (CID 141376880) is 6-methyl-3,4-dihydroacridin-9-amine.
What is the SMILES notation for 6-methyl-3,4-dihydroacridin-9-amine?
The canonical SMILES for 6-methyl-3,4-dihydroacridin-9-amine is Cc1ccc2c(N)c3c(nc2c1)CCC=C3.
What is the InChIKey of 6-methyl-3,4-dihydroacridin-9-amine?
The InChIKey is MKOMZRZNEJJQST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2/c1-9-6-7-11-13(8-9)16-12-5-3-2-4-10(12)14(11)15/h2,4,6-8H,3,5H2,1H3,(H2,15,16).
What are the key properties of 6-methyl-3,4-dihydroacridin-9-amine?
6-methyl-3,4-dihydroacridin-9-amine has a molecular weight of 210.28 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydroacridin-9-amine is sourced from PubChem (CID 141376880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).