About 4-methylazetidine-2,3-dione
4-methylazetidine-2,3-dione (PubChem CID 141376893) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is 4-methylazetidine-2,3-dione.
Molecular Properties
| Compound Name | 4-methylazetidine-2,3-dione |
| PubChem CID | 141376893 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 4-methylazetidine-2,3-dione |
| SMILES | CC1NC(=O)C1=O |
| InChI | InChI=1S/C4H5NO2/c1-2-3(6)4(7)5-2/h2H,1H3,(H,5,7) |
| InChIKey | DQGVWEZQFNLLEM-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methylazetidine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylazetidine-2,3-dione?
The IUPAC name of 4-methylazetidine-2,3-dione (CID 141376893) is 4-methylazetidine-2,3-dione.
What is the SMILES notation for 4-methylazetidine-2,3-dione?
The canonical SMILES for 4-methylazetidine-2,3-dione is CC1NC(=O)C1=O.
What is the InChIKey of 4-methylazetidine-2,3-dione?
The InChIKey is DQGVWEZQFNLLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c1-2-3(6)4(7)5-2/h2H,1H3,(H,5,7).
What are the key properties of 4-methylazetidine-2,3-dione?
4-methylazetidine-2,3-dione has a molecular weight of 99.09 g/mol, XLogP of -0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylazetidine-2,3-dione is sourced from PubChem (CID 141376893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).