C4H5NO2 — CID 141376893
4-methylazetidine-2,3-dione (PubChem CID 141376893) has the molecular formula C4H5NO2 and a molecular weight of 99.09 g/mol. Its IUPAC name is 4-methylazetidine-2,3-dione.
| Compound Name | 4-methylazetidine-2,3-dione |
|---|---|
| PubChem CID | 141376893 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 4-methylazetidine-2,3-dione |
| SMILES | CC1NC(=O)C1=O |
| InChI | InChI=1S/C4H5NO2/c1-2-3(6)4(7)5-2/h2H,1H3,(H,5,7) |
| InChIKey | DQGVWEZQFNLLEM-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|