C10H19NO3S — CID 1413771
(3R,4R)-4-(cyclohexylamino)-1,1-dioxothiolan-3-ol (PubChem CID 1413771) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is (3R,4R)-4-(cyclohexylamino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4R)-4-(cyclohexylamino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 1413771 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (3R,4R)-4-(cyclohexylamino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@H](NC2CCCCC2)[C@@H](O)C1 |
| InChI | InChI=1S/C10H19NO3S/c12-10-7-15(13,14)6-9(10)11-8-4-2-1-3-5-8/h8-12H,1-7H2/t9-,10-/m0/s1 |
| InChIKey | QJXHLODFVYVUCV-UWVGGRQHSA-N |
| XLogP | 0.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |