About 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol
1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol (PubChem CID 141377133) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol.
Molecular Properties
| Compound Name | 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol |
| PubChem CID | 141377133 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol |
| SMILES | C=CCC(O)C[C@H]1CNC(C)(C)C1 |
| InChI | InChI=1S/C11H21NO/c1-4-5-10(13)6-9-7-11(2,3)12-8-9/h4,9-10,12-13H,1,5-8H2,2-3H3/t9-,10?/m1/s1 |
| InChIKey | KMIAXAIZQHYRBX-YHMJZVADSA-N |
| XLogP | 1.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol?
The IUPAC name of 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol (CID 141377133) is 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol.
What is the SMILES notation for 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol?
The canonical SMILES for 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol is C=CCC(O)C[C@H]1CNC(C)(C)C1.
What is the InChIKey of 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol?
The InChIKey is KMIAXAIZQHYRBX-YHMJZVADSA-N. The full InChI is InChI=1S/C11H21NO/c1-4-5-10(13)6-9-7-11(2,3)12-8-9/h4,9-10,12-13H,1,5-8H2,2-3H3/t9-,10?/m1/s1.
What are the key properties of 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol?
1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol has a molecular weight of 183.29 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-5,5-dimethylpyrrolidin-3-yl]pent-4-en-2-ol is sourced from PubChem (CID 141377133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).