C13H23N3O3 — CID 141377139
N-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-3-yl]-2-methylhexanamide (PubChem CID 141377139) has the molecular formula C13H23N3O3 and a molecular weight of 269.35 g/mol. Its IUPAC name is N-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-3-yl]-2-methylhexanamide.
| Compound Name | N-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-3-yl]-2-methylhexanamide |
|---|---|
| PubChem CID | 141377139 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-[1-[(2R)-2,3-dihydroxypropyl]pyrazol-3-yl]-2-methylhexanamide |
| SMILES | CCCCC(C)C(=O)Nc1ccn(C[C@@H](O)CO)n1 |
| InChI | InChI=1S/C13H23N3O3/c1-3-4-5-10(2)13(19)14-12-6-7-16(15-12)8-11(18)9-17/h6-7,10-11,17-18H,3-5,8-9H2,1-2H3,(H,14,15,19)/t10?,11-/m1/s1 |
| InChIKey | JZFJWDGFQKSTPK-RRKGBCIJSA-N |
| XLogP | 1.00 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |