About 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole
5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole (PubChem CID 141379157) has the molecular formula C14H16BrN3O
and a molecular weight of 322.21 g/mol. Its IUPAC name is 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole |
| PubChem CID | 141379157 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole |
| SMILES | CO[C@@H]1CN[C@@H](n2cncc2-c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C14H16BrN3O/c1-19-12-6-14(17-7-12)18-9-16-8-13(18)10-2-4-11(15)5-3-10/h2-5,8-9,12,14,17H,6-7H2,1H3/t12-,14-/m0/s1 |
| InChIKey | ORRKSEKXYLGLOB-JSGCOSHPSA-N |
| XLogP | 2.82 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole?
The IUPAC name of 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole (CID 141379157) is 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole.
What is the SMILES notation for 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole?
The canonical SMILES for 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole is CO[C@@H]1CN[C@@H](n2cncc2-c2ccc(Br)cc2)C1.
What is the InChIKey of 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole?
The InChIKey is ORRKSEKXYLGLOB-JSGCOSHPSA-N. The full InChI is InChI=1S/C14H16BrN3O/c1-19-12-6-14(17-7-12)18-9-16-8-13(18)10-2-4-11(15)5-3-10/h2-5,8-9,12,14,17H,6-7H2,1H3/t12-,14-/m0/s1.
What are the key properties of 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole?
5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole has a molecular weight of 322.21 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-1-[(2S,4S)-4-methoxypyrrolidin-2-yl]imidazole is sourced from PubChem (CID 141379157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).