About 4H-1,3-dioxine-2-carboxamide
4H-1,3-dioxine-2-carboxamide (PubChem CID 141379284) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is 4H-1,3-dioxine-2-carboxamide.
Molecular Properties
| Compound Name | 4H-1,3-dioxine-2-carboxamide |
| PubChem CID | 141379284 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 4H-1,3-dioxine-2-carboxamide |
| SMILES | NC(=O)C1OC=CCO1 |
| InChI | InChI=1S/C5H7NO3/c6-4(7)5-8-2-1-3-9-5/h1-2,5H,3H2,(H2,6,7) |
| InChIKey | BZHSSGXJLUHDCZ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-1,3-dioxine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-1,3-dioxine-2-carboxamide?
The IUPAC name of 4H-1,3-dioxine-2-carboxamide (CID 141379284) is 4H-1,3-dioxine-2-carboxamide.
What is the SMILES notation for 4H-1,3-dioxine-2-carboxamide?
The canonical SMILES for 4H-1,3-dioxine-2-carboxamide is NC(=O)C1OC=CCO1.
What is the InChIKey of 4H-1,3-dioxine-2-carboxamide?
The InChIKey is BZHSSGXJLUHDCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c6-4(7)5-8-2-1-3-9-5/h1-2,5H,3H2,(H2,6,7).
What are the key properties of 4H-1,3-dioxine-2-carboxamide?
4H-1,3-dioxine-2-carboxamide has a molecular weight of 129.11 g/mol, XLogP of -0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-1,3-dioxine-2-carboxamide is sourced from PubChem (CID 141379284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).