About 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine
4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine (PubChem CID 141379287) has the molecular formula C22H32O3
and a molecular weight of 344.50 g/mol. Its IUPAC name is 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine.
Molecular Properties
| Compound Name | 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine |
| PubChem CID | 141379287 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine |
| SMILES | COc1cc(C)c2c(c1)OCOC2(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H32O3/c1-16-13-19(23-2)14-20-21(16)22(25-15-24-20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h13-14,17-18H,3-12,15H2,1-2H3 |
| InChIKey | LNCFXFWQBYNKBT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine?
The IUPAC name of 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine (CID 141379287) is 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine.
What is the SMILES notation for 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine?
The canonical SMILES for 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine is COc1cc(C)c2c(c1)OCOC2(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine?
The InChIKey is LNCFXFWQBYNKBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O3/c1-16-13-19(23-2)14-20-21(16)22(25-15-24-20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h13-14,17-18H,3-12,15H2,1-2H3.
What are the key properties of 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine?
4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine has a molecular weight of 344.50 g/mol, XLogP of 5.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dicyclohexyl-7-methoxy-5-methyl-1,3-benzodioxine is sourced from PubChem (CID 141379287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).