C20H28BClO2 — CID 141379648
3-[(1S)-1-chloro-2-(3-ethylphenyl)ethyl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane (PubChem CID 141379648) has the molecular formula C20H28BClO2 and a molecular weight of 346.71 g/mol. Its IUPAC name is 3-[(1S)-1-chloro-2-(3-ethylphenyl)ethyl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane.
| Compound Name | 3-[(1S)-1-chloro-2-(3-ethylphenyl)ethyl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane |
|---|---|
| PubChem CID | 141379648 |
| Molecular Formula | C20H28BClO2 |
| Molecular Weight | 346.71 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[(1S)-1-chloro-2-(3-ethylphenyl)ethyl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane |
| SMILES | CCc1cccc(C[C@@H](Cl)B2OC3(C)CCC4CC3(O2)C4(C)C)c1 |
| InChI | InChI=1S/C20H28BClO2/c1-5-14-7-6-8-15(11-14)12-17(22)21-23-19(4)10-9-16-13-20(19,24-21)18(16,2)3/h6-8,11,16-17H,5,9-10,12-13H2,1-4H3/t16?,17-,19?,20?/m1/s1 |
| InChIKey | ZTNGQFQJWHMJNL-KWTWZXGMSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.71 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|