C20H19FN2 — CID 141382414
(3aR,6aR)-1-[5-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole (PubChem CID 141382414) has the molecular formula C20H19FN2 and a molecular weight of 306.38 g/mol. Its IUPAC name is (3aR,6aR)-1-[5-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole.
| Compound Name | (3aR,6aR)-1-[5-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 141382414 |
| Molecular Formula | C20H19FN2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3aR,6aR)-1-[5-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole |
| SMILES | Fc1ccc(C#Cc2ccc(N3CC[C@H]4CCC[C@H]43)nc2)cc1 |
| InChI | InChI=1S/C20H19FN2/c21-18-9-6-15(7-10-18)4-5-16-8-11-20(22-14-16)23-13-12-17-2-1-3-19(17)23/h6-11,14,17,19H,1-3,12-13H2/t17-,19-/m1/s1 |
| InChIKey | ZGTZIVRIMDFTKU-IEBWSBKVSA-N |
| XLogP | 4.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|