C21H25N3O3S — CID 141383314
1-[4-(cyclohexylamino)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridine-5-carbaldehyde (PubChem CID 141383314) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-[4-(cyclohexylamino)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridine-5-carbaldehyde.
| Compound Name | 1-[4-(cyclohexylamino)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 141383314 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-[4-(cyclohexylamino)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridine-5-carbaldehyde |
| SMILES | CC1(S(=O)(=O)n2ccc3cc(C=O)cnc32)C=CC(NC2CCCCC2)=CC1 |
| InChI | InChI=1S/C21H25N3O3S/c1-21(10-7-19(8-11-21)23-18-5-3-2-4-6-18)28(26,27)24-12-9-17-13-16(15-25)14-22-20(17)24/h7-10,12-15,18,23H,2-6,11H2,1H3 |
| InChIKey | FZCRHWFDKUAQLT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|