C22H24N6O2S — CID 141383356
2-[8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]bicyclo[2.2.2]octan-1-amine (PubChem CID 141383356) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-[8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]bicyclo[2.2.2]octan-1-amine.
| Compound Name | 2-[8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]bicyclo[2.2.2]octan-1-amine |
|---|---|
| PubChem CID | 141383356 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[8-(2-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]bicyclo[2.2.2]octan-1-amine |
| SMILES | Cc1ccccc1S(=O)(=O)c1nc2[nH]ccc2n2c(C3CC4CCC3(N)CC4)nnc12 |
| InChI | InChI=1S/C22H24N6O2S/c1-13-4-2-3-5-17(13)31(29,30)21-20-27-26-19(28(20)16-8-11-24-18(16)25-21)15-12-14-6-9-22(15,23)10-7-14/h2-5,8,11,14-15,24H,6-7,9-10,12,23H2,1H3 |
| InChIKey | AUGDBEAMXGJKJT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |