About 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole
3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole (PubChem CID 141383498) has the molecular formula C15H10BrClFN
and a molecular weight of 338.61 g/mol. Its IUPAC name is 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole |
| PubChem CID | 141383498 |
| Molecular Formula | C15H10BrClFN |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole |
| SMILES | Fc1c(Br)cccc1C=C1CNc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H10BrClFN/c16-13-3-1-2-9(15(13)18)6-10-8-19-14-7-11(17)4-5-12(10)14/h1-7,19H,8H2 |
| InChIKey | LSYZEJLVVZRRPL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole?
The IUPAC name of 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole (CID 141383498) is 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole.
What is the SMILES notation for 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole?
The canonical SMILES for 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole is Fc1c(Br)cccc1C=C1CNc2cc(Cl)ccc21.
What is the InChIKey of 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole?
The InChIKey is LSYZEJLVVZRRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrClFN/c16-13-3-1-2-9(15(13)18)6-10-8-19-14-7-11(17)4-5-12(10)14/h1-7,19H,8H2.
What are the key properties of 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole?
3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole has a molecular weight of 338.61 g/mol, XLogP of 5.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-bromo-2-fluorophenyl)methylidene]-6-chloro-1,2-dihydroindole is sourced from PubChem (CID 141383498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).