C21H24N4O2 — CID 141383701
[(2R)-3-methylbutan-2-yl] N-[5-methyl-3-(4-phenylphenyl)triazol-4-yl]carbamate (PubChem CID 141383701) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is [(2R)-3-methylbutan-2-yl] N-[5-methyl-3-(4-phenylphenyl)triazol-4-yl]carbamate.
| Compound Name | [(2R)-3-methylbutan-2-yl] N-[5-methyl-3-(4-phenylphenyl)triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 141383701 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(2R)-3-methylbutan-2-yl] N-[5-methyl-3-(4-phenylphenyl)triazol-4-yl]carbamate |
| SMILES | Cc1nnn(-c2ccc(-c3ccccc3)cc2)c1NC(=O)O[C@H](C)C(C)C |
| InChI | InChI=1S/C21H24N4O2/c1-14(2)16(4)27-21(26)22-20-15(3)23-24-25(20)19-12-10-18(11-13-19)17-8-6-5-7-9-17/h5-14,16H,1-4H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | FZROACFRQDFRFF-MRXNPFEDSA-N |
| XLogP | 4.84 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |