C15H22N8O2 — CID 141385671
N'-acetyl-N'-[1-(1H-pyrazol-5-ylmethylamino)-1-(pyrimidin-2-ylmethylamino)ethyl]acetohydrazide (PubChem CID 141385671) has the molecular formula C15H22N8O2 and a molecular weight of 346.40 g/mol. Its IUPAC name is N'-acetyl-N'-[1-(1H-pyrazol-5-ylmethylamino)-1-(pyrimidin-2-ylmethylamino)ethyl]acetohydrazide.
| Compound Name | N'-acetyl-N'-[1-(1H-pyrazol-5-ylmethylamino)-1-(pyrimidin-2-ylmethylamino)ethyl]acetohydrazide |
|---|---|
| PubChem CID | 141385671 |
| Molecular Formula | C15H22N8O2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N'-acetyl-N'-[1-(1H-pyrazol-5-ylmethylamino)-1-(pyrimidin-2-ylmethylamino)ethyl]acetohydrazide |
| SMILES | CC(=O)NN(C(C)=O)C(C)(NCc1ncccn1)NCc1ccn[nH]1 |
| InChI | InChI=1S/C15H22N8O2/c1-11(24)22-23(12(2)25)15(3,18-9-13-5-8-20-21-13)19-10-14-16-6-4-7-17-14/h4-8,18-19H,9-10H2,1-3H3,(H,20,21)(H,22,24) |
| InChIKey | MPPNUZQGTQCJEC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|