C22H25FN2O4 — CID 141386050
2-(2-fluoro-4,5-dimethoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one (PubChem CID 141386050) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-(2-fluoro-4,5-dimethoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one.
| Compound Name | 2-(2-fluoro-4,5-dimethoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141386050 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(2-fluoro-4,5-dimethoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(F)c(C2CC(=O)c3cc(N4CCN[C@@H](C)C4)ccc3O2)cc1OC |
| InChI | InChI=1S/C22H25FN2O4/c1-13-12-25(7-6-24-13)14-4-5-19-16(8-14)18(26)11-20(29-19)15-9-21(27-2)22(28-3)10-17(15)23/h4-5,8-10,13,20,24H,6-7,11-12H2,1-3H3/t13-,20?/m0/s1 |
| InChIKey | BPYSKYWCXPOXKO-SZQRVLIRSA-N |
| XLogP | 3.35 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|