C19H21N3O3 — CID 141386053
2-(6-methoxy-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one (PubChem CID 141386053) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141386053 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(C2CC(=O)c3cc(N4CCNCC4)ccc3O2)cn1 |
| InChI | InChI=1S/C19H21N3O3/c1-24-19-5-2-13(12-21-19)18-11-16(23)15-10-14(3-4-17(15)25-18)22-8-6-20-7-9-22/h2-5,10,12,18,20H,6-9,11H2,1H3 |
| InChIKey | MELOHUDRHMFSQQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|