C18H18FN3O2 — CID 141386086
2-(5-fluoro-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one (PubChem CID 141386086) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(5-fluoro-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one.
| Compound Name | 2-(5-fluoro-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141386086 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(5-fluoro-3-pyridinyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2cncc(F)c2)Oc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C18H18FN3O2/c19-13-7-12(10-21-11-13)18-9-16(23)15-8-14(1-2-17(15)24-18)22-5-3-20-4-6-22/h1-2,7-8,10-11,18,20H,3-6,9H2 |
| InChIKey | BXAUGMXKFBSTPB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|