C18H36N2O4 — CID 141386266
1,10-diazabicyclo[8.5.5]icosane-2,2,3,3-tetrol (PubChem CID 141386266) has the molecular formula C18H36N2O4 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1,10-diazabicyclo[8.5.5]icosane-2,2,3,3-tetrol.
| Compound Name | 1,10-diazabicyclo[8.5.5]icosane-2,2,3,3-tetrol |
|---|---|
| PubChem CID | 141386266 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 1,10-diazabicyclo[8.5.5]icosane-2,2,3,3-tetrol |
| SMILES | OC1(O)CCCCCCN2CCCCCN(CCCCC2)C1(O)O |
| InChI | InChI=1S/C18H36N2O4/c21-17(22)11-5-1-2-6-12-19-13-7-3-9-15-20(18(17,23)24)16-10-4-8-14-19/h21-24H,1-16H2 |
| InChIKey | PNPACJUDSBJWFC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|