About N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide
N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide (PubChem CID 141387193) has the molecular formula C3H3N9O2
and a molecular weight of 197.12 g/mol. Its IUPAC name is N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide.
Molecular Properties
| Compound Name | N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide |
| PubChem CID | 141387193 |
| Molecular Formula | C3H3N9O2 |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide |
| SMILES | O=[N+]([O-])Nc1ncnn1-c1nn[nH]n1 |
| InChI | InChI=1S/C3H3N9O2/c13-12(14)8-2-4-1-5-11(2)3-6-9-10-7-3/h1H,(H,4,5,8)(H,6,7,9,10) |
| InChIKey | DPUCYWNKNBDDCR-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide?
The IUPAC name of N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide (CID 141387193) is N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide.
What is the SMILES notation for N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide?
The canonical SMILES for N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide is O=[N+]([O-])Nc1ncnn1-c1nn[nH]n1.
What is the InChIKey of N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide?
The InChIKey is DPUCYWNKNBDDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N9O2/c13-12(14)8-2-4-1-5-11(2)3-6-9-10-7-3/h1H,(H,4,5,8)(H,6,7,9,10).
What are the key properties of N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide?
N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide has a molecular weight of 197.12 g/mol, XLogP of -1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]nitramide is sourced from PubChem (CID 141387193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).