C16H22O3 — CID 141387799
2-[6-(4-ethylphenoxy)hexa-2,4-dienoxy]ethanol (PubChem CID 141387799) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[6-(4-ethylphenoxy)hexa-2,4-dienoxy]ethanol.
| Compound Name | 2-[6-(4-ethylphenoxy)hexa-2,4-dienoxy]ethanol |
|---|---|
| PubChem CID | 141387799 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-[6-(4-ethylphenoxy)hexa-2,4-dienoxy]ethanol |
| SMILES | CCc1ccc(OCC=CC=CCOCCO)cc1 |
| InChI | InChI=1S/C16H22O3/c1-2-15-7-9-16(10-8-15)19-13-6-4-3-5-12-18-14-11-17/h3-10,17H,2,11-14H2,1H3 |
| InChIKey | VGGCRCATJQXFMR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|