C8H14N2O6S2 — CID 141389232
1-(1-methylimidazol-2-yl)sulfonyloxybutane-1-sulfonic acid (PubChem CID 141389232) has the molecular formula C8H14N2O6S2 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-(1-methylimidazol-2-yl)sulfonyloxybutane-1-sulfonic acid.
| Compound Name | 1-(1-methylimidazol-2-yl)sulfonyloxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 141389232 |
| Molecular Formula | C8H14N2O6S2 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-(1-methylimidazol-2-yl)sulfonyloxybutane-1-sulfonic acid |
| SMILES | CCCC(OS(=O)(=O)c1nccn1C)S(=O)(=O)O |
| InChI | InChI=1S/C8H14N2O6S2/c1-3-4-7(17(11,12)13)16-18(14,15)8-9-5-6-10(8)2/h5-7H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | XCGGHKBGDLIKQO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|