C13H17F9O — CID 141389871
2,2,6,6-tetramethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane (PubChem CID 141389871) has the molecular formula C13H17F9O and a molecular weight of 360.26 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane.
| Compound Name | 2,2,6,6-tetramethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane |
|---|---|
| PubChem CID | 141389871 |
| Molecular Formula | C13H17F9O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane |
| SMILES | CC1(C)CC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(C)(C)O1 |
| InChI | InChI=1S/C13H17F9O/c1-8(2)5-7(6-9(3,4)23-8)10(14,15)11(16,17)12(18,19)13(20,21)22/h7H,5-6H2,1-4H3 |
| InChIKey | CAHZIUSVWZBBBZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|