C32H38O3 — CID 14138991
1-[(2R,5S,6R)-5-methyl-6-propan-2-yl-2-(2,2,2-triphenylethoxy)oxan-2-yl]propan-2-one (PubChem CID 14138991) has the molecular formula C32H38O3 and a molecular weight of 470.65 g/mol. Its IUPAC name is 1-[(2R,5S,6R)-5-methyl-6-propan-2-yl-2-(2,2,2-triphenylethoxy)oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,5S,6R)-5-methyl-6-propan-2-yl-2-(2,2,2-triphenylethoxy)oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 14138991 |
| Molecular Formula | C32H38O3 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 1-[(2R,5S,6R)-5-methyl-6-propan-2-yl-2-(2,2,2-triphenylethoxy)oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@]1(OCC(c2ccccc2)(c2ccccc2)c2ccccc2)CC[C@H](C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C32H38O3/c1-24(2)30-25(3)20-21-31(35-30,22-26(4)33)34-23-32(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-19,24-25,30H,20-23H2,1-4H3/t25-,30+,31+/m0/s1 |
| InChIKey | DDCQVLPPAMJPHZ-WXKJZWBCSA-N |
| XLogP | 7.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|