C15H13F3N2O3 — CID 141390027
methyl 2-[[[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoate (PubChem CID 141390027) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is methyl 2-[[[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoate.
| Compound Name | methyl 2-[[[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 141390027 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 2-[[[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1CNc1ccc(=O)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O3/c1-23-14(22)10-5-3-2-4-9(10)8-19-11-6-7-12(21)20-13(11)15(16,17)18/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | OEXGNHILODZCRP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |