C19H18Cl4FNO3 — CID 141390600
[2,6-dichloro-6-fluoro-3-(5-methoxyiminopentyl)cyclohexa-2,4-dien-1-yl] 2,4-dichlorobenzoate (PubChem CID 141390600) has the molecular formula C19H18Cl4FNO3 and a molecular weight of 469.17 g/mol. Its IUPAC name is [2,6-dichloro-6-fluoro-3-(5-methoxyiminopentyl)cyclohexa-2,4-dien-1-yl] 2,4-dichlorobenzoate.
| Compound Name | [2,6-dichloro-6-fluoro-3-(5-methoxyiminopentyl)cyclohexa-2,4-dien-1-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 141390600 |
| Molecular Formula | C19H18Cl4FNO3 |
| Molecular Weight | 469.17 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | [2,6-dichloro-6-fluoro-3-(5-methoxyiminopentyl)cyclohexa-2,4-dien-1-yl] 2,4-dichlorobenzoate |
| SMILES | CON=CCCCCC1=C(Cl)C(OC(=O)c2ccc(Cl)cc2Cl)C(F)(Cl)C=C1 |
| InChI | InChI=1S/C19H18Cl4FNO3/c1-27-25-10-4-2-3-5-12-8-9-19(23,24)17(16(12)22)28-18(26)14-7-6-13(20)11-15(14)21/h6-11,17H,2-5H2,1H3 |
| InChIKey | QUAUAEFTMSJWNR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.17 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|