C12H18Cl2N4 — CID 141390759
1-N-quinoxalin-2-ylbutane-1,2-diamine;dihydrochloride (PubChem CID 141390759) has the molecular formula C12H18Cl2N4 and a molecular weight of 289.21 g/mol. Its IUPAC name is 1-N-quinoxalin-2-ylbutane-1,2-diamine;dihydrochloride.
| Compound Name | 1-N-quinoxalin-2-ylbutane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 141390759 |
| Molecular Formula | C12H18Cl2N4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-N-quinoxalin-2-ylbutane-1,2-diamine;dihydrochloride |
| SMILES | CCC(N)CNc1cnc2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C12H16N4.2ClH/c1-2-9(13)7-15-12-8-14-10-5-3-4-6-11(10)16-12;;/h3-6,8-9H,2,7,13H2,1H3,(H,15,16);2*1H |
| InChIKey | ZTXCANAGVZFWDW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |