C19H16N2O4S2 — CID 141391200
5-[[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfinylamino]methyl]thiophene-2-carboxylic acid (PubChem CID 141391200) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-[[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfinylamino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfinylamino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 141391200 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 5-[[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfinylamino]methyl]thiophene-2-carboxylic acid |
| SMILES | CCN1C(=O)c2cccc3c(S(=O)NCc4ccc(C(=O)O)s4)ccc1c23 |
| InChI | InChI=1S/C19H16N2O4S2/c1-2-21-14-7-9-16(12-4-3-5-13(17(12)14)18(21)22)27(25)20-10-11-6-8-15(26-11)19(23)24/h3-9,20H,2,10H2,1H3,(H,23,24) |
| InChIKey | GUZQFZPZHPCNRL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |