C14H10 — CID 141391769
tetracyclo[9.2.1.05,13.07,12]tetradeca-1,3,5,7,11(14),12-hexaene (PubChem CID 141391769) has the molecular formula C14H10 and a molecular weight of 178.23 g/mol. Its IUPAC name is tetracyclo[9.2.1.05,13.07,12]tetradeca-1,3,5,7,11(14),12-hexaene.
| Compound Name | tetracyclo[9.2.1.05,13.07,12]tetradeca-1,3,5,7,11(14),12-hexaene |
|---|---|
| PubChem CID | 141391769 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | tetracyclo[9.2.1.05,13.07,12]tetradeca-1,3,5,7,11(14),12-hexaene |
| SMILES | C1=c2cc3cccc4cc(c2=c43)CC1 |
| InChI | InChI=1S/C14H10/c1-3-9-7-11-5-2-6-12-8-10(4-1)13(9)14(11)12/h1,3-5,7-8H,2,6H2 |
| InChIKey | ZGHQHIHSCVMRAA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |