About 2,5-dibromo-3-(3,4-dibromohexyl)thiophene
2,5-dibromo-3-(3,4-dibromohexyl)thiophene (PubChem CID 141391851) has the molecular formula C10H12Br4S
and a molecular weight of 483.89 g/mol. Its IUPAC name is 2,5-dibromo-3-(3,4-dibromohexyl)thiophene.
Molecular Properties
| Compound Name | 2,5-dibromo-3-(3,4-dibromohexyl)thiophene |
| PubChem CID | 141391851 |
| Molecular Formula | C10H12Br4S |
| Molecular Weight | 483.89 g/mol |
| Exact Mass | 479.74 |
| IUPAC Name | 2,5-dibromo-3-(3,4-dibromohexyl)thiophene |
| SMILES | CCC(Br)C(Br)CCc1cc(Br)sc1Br |
| InChI | InChI=1S/C10H12Br4S/c1-2-7(11)8(12)4-3-6-5-9(13)15-10(6)14/h5,7-8H,2-4H2,1H3 |
| InChIKey | TXIXVLDDLSUNAC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.89 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromo-3-(3,4-dibromohexyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-3-(3,4-dibromohexyl)thiophene?
The IUPAC name of 2,5-dibromo-3-(3,4-dibromohexyl)thiophene (CID 141391851) is 2,5-dibromo-3-(3,4-dibromohexyl)thiophene.
What is the SMILES notation for 2,5-dibromo-3-(3,4-dibromohexyl)thiophene?
The canonical SMILES for 2,5-dibromo-3-(3,4-dibromohexyl)thiophene is CCC(Br)C(Br)CCc1cc(Br)sc1Br.
What is the InChIKey of 2,5-dibromo-3-(3,4-dibromohexyl)thiophene?
The InChIKey is TXIXVLDDLSUNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br4S/c1-2-7(11)8(12)4-3-6-5-9(13)15-10(6)14/h5,7-8H,2-4H2,1H3.
What are the key properties of 2,5-dibromo-3-(3,4-dibromohexyl)thiophene?
2,5-dibromo-3-(3,4-dibromohexyl)thiophene has a molecular weight of 483.89 g/mol, XLogP of 6.14, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-3-(3,4-dibromohexyl)thiophene is sourced from PubChem (CID 141391851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).