About 3,4-dihydro-2H-pyrido[1,2-a]pyrazine
3,4-dihydro-2H-pyrido[1,2-a]pyrazine (PubChem CID 141392089) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrido[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrazine |
| PubChem CID | 141392089 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrazine |
| SMILES | C1=CC2=CNCCN2C=C1 |
| InChI | InChI=1S/C8H10N2/c1-2-5-10-6-4-9-7-8(10)3-1/h1-3,5,7,9H,4,6H2 |
| InChIKey | DQALQYJYOJVSQJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-pyrido[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrido[1,2-a]pyrazine?
The IUPAC name of 3,4-dihydro-2H-pyrido[1,2-a]pyrazine (CID 141392089) is 3,4-dihydro-2H-pyrido[1,2-a]pyrazine.
What is the SMILES notation for 3,4-dihydro-2H-pyrido[1,2-a]pyrazine?
The canonical SMILES for 3,4-dihydro-2H-pyrido[1,2-a]pyrazine is C1=CC2=CNCCN2C=C1.
What is the InChIKey of 3,4-dihydro-2H-pyrido[1,2-a]pyrazine?
The InChIKey is DQALQYJYOJVSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-5-10-6-4-9-7-8(10)3-1/h1-3,5,7,9H,4,6H2.
What are the key properties of 3,4-dihydro-2H-pyrido[1,2-a]pyrazine?
3,4-dihydro-2H-pyrido[1,2-a]pyrazine has a molecular weight of 134.18 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrido[1,2-a]pyrazine is sourced from PubChem (CID 141392089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).