C18H30N4O3 — CID 141392105
2-[2-[2-(butylamino)ethylamino]ethylcarbamoylamino]-3-phenylpropanoic acid (PubChem CID 141392105) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[2-[2-(butylamino)ethylamino]ethylcarbamoylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[2-[2-(butylamino)ethylamino]ethylcarbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 141392105 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2-[2-[2-(butylamino)ethylamino]ethylcarbamoylamino]-3-phenylpropanoic acid |
| SMILES | CCCCNCCNCCNC(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H30N4O3/c1-2-3-9-19-10-11-20-12-13-21-18(25)22-16(17(23)24)14-15-7-5-4-6-8-15/h4-8,16,19-20H,2-3,9-14H2,1H3,(H,23,24)(H2,21,22,25) |
| InChIKey | JMJKHHNCJHEGRK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|