About 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine
6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine (PubChem CID 141392136) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine |
| PubChem CID | 141392136 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cccc2c1oc1c(N)nc(N)nc12 |
| InChI | InChI=1S/C11H10N4O/c1-5-3-2-4-6-7-9(16-8(5)6)10(12)15-11(13)14-7/h2-4H,1H3,(H4,12,13,14,15) |
| InChIKey | CFKDMBGBAYTZHD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine?
The IUPAC name of 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine (CID 141392136) is 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine.
What is the SMILES notation for 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine?
The canonical SMILES for 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine is Cc1cccc2c1oc1c(N)nc(N)nc12.
What is the InChIKey of 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine?
The InChIKey is CFKDMBGBAYTZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c1-5-3-2-4-6-7-9(16-8(5)6)10(12)15-11(13)14-7/h2-4H,1H3,(H4,12,13,14,15).
What are the key properties of 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine?
6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine has a molecular weight of 214.23 g/mol, XLogP of 1.85, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1]benzofuro[3,2-d]pyrimidine-2,4-diamine is sourced from PubChem (CID 141392136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).