C15H17N3 — CID 141392151
(9Z,11Z)-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),9,11,13,15-hexaen-4-amine (PubChem CID 141392151) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is (9Z,11Z)-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),9,11,13,15-hexaen-4-amine.
| Compound Name | (9Z,11Z)-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),9,11,13,15-hexaen-4-amine |
|---|---|
| PubChem CID | 141392151 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | (9Z,11Z)-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),9,11,13,15-hexaen-4-amine |
| SMILES | NC1NCC2=C(N1)c1ccccc1/C=C\C=C/C2 |
| InChI | InChI=1S/C15H17N3/c16-15-17-10-12-8-3-1-2-6-11-7-4-5-9-13(11)14(12)18-15/h1-7,9,15,17-18H,8,10,16H2/b3-1-,6-2- |
| InChIKey | DOVZHLUHHOFWGR-SJDXMKNESA-N |
| XLogP | 1.81 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |