C15H16FN5O — CID 141392209
N-fluoro-4-(4-methylpiperazin-1-yl)-[1]benzofuro[3,2-d]pyrimidin-2-amine (PubChem CID 141392209) has the molecular formula C15H16FN5O and a molecular weight of 301.32 g/mol. Its IUPAC name is N-fluoro-4-(4-methylpiperazin-1-yl)-[1]benzofuro[3,2-d]pyrimidin-2-amine.
| Compound Name | N-fluoro-4-(4-methylpiperazin-1-yl)-[1]benzofuro[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141392209 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-fluoro-4-(4-methylpiperazin-1-yl)-[1]benzofuro[3,2-d]pyrimidin-2-amine |
| SMILES | CN1CCN(c2nc(NF)nc3c2oc2ccccc23)CC1 |
| InChI | InChI=1S/C15H16FN5O/c1-20-6-8-21(9-7-20)14-13-12(17-15(18-14)19-16)10-4-2-3-5-11(10)22-13/h2-5H,6-9H2,1H3,(H,17,18,19) |
| InChIKey | MLSWHHVFUZYNQK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|