About (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine
(2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine (PubChem CID 141392275) has the molecular formula C9H17F2NO2
and a molecular weight of 209.24 g/mol. Its IUPAC name is (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine |
| PubChem CID | 141392275 |
| Molecular Formula | C9H17F2NO2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine |
| SMILES | CCOC(C)OC[C@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C9H17F2NO2/c1-3-13-7(2)14-5-8-4-9(10,11)6-12-8/h7-8,12H,3-6H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | BMJGTZGQJCVCLC-BRFYHDHCSA-N |
| XLogP | 1.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine?
The IUPAC name of (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine (CID 141392275) is (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine.
What is the SMILES notation for (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine?
The canonical SMILES for (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine is CCOC(C)OC[C@H]1CC(F)(F)CN1.
What is the InChIKey of (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine?
The InChIKey is BMJGTZGQJCVCLC-BRFYHDHCSA-N. The full InChI is InChI=1S/C9H17F2NO2/c1-3-13-7(2)14-5-8-4-9(10,11)6-12-8/h7-8,12H,3-6H2,1-2H3/t7?,8-/m1/s1.
What are the key properties of (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine?
(2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine has a molecular weight of 209.24 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1-ethoxyethoxymethyl)-4,4-difluoropyrrolidine is sourced from PubChem (CID 141392275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).